Melatonin (10mg) One box

Melatonin is a hormone made by the pineal gland that can activates melatonin receptor. Melatonin plays a role in sleep and possesses important antioxidative and anti-inflammatory properties. Melatonin is a novel selective ATF-6 inhibitor and induces human hepatoma cell apoptosis through COX-2 downregulation. Melatonin attenuates palmitic acid-induced (HY-N0830) mouse granulosa cells apoptosis via endoplasmic reticulum stress.

Formula: C₁₃H₁₆N₂O₂

CAS No.: 73-31-4

SMILES: CC(NCCC1=CNC2=C1C=C(OC)C=C2)=O